About N-(2,4,6-trinitrophenyl)pyridin-2-amine
N-(2,4,6-trinitrophenyl)pyridin-2-amine (PubChem CID 3089122) has the molecular formula C11H7N5O6
and a molecular weight of 305.21 g/mol. Its IUPAC name is N-(2,4,6-trinitrophenyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-(2,4,6-trinitrophenyl)pyridin-2-amine |
| PubChem CID | 3089122 |
| Molecular Formula | C11H7N5O6 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | N-(2,4,6-trinitrophenyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccccn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H7N5O6/c17-14(18)7-5-8(15(19)20)11(9(6-7)16(21)22)13-10-3-1-2-4-12-10/h1-6H,(H,12,13) |
| InChIKey | DIPBIKKKLNWSEW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 154.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4,6-trinitrophenyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4,6-trinitrophenyl)pyridin-2-amine?
The IUPAC name of N-(2,4,6-trinitrophenyl)pyridin-2-amine (CID 3089122) is N-(2,4,6-trinitrophenyl)pyridin-2-amine.
What is the SMILES notation for N-(2,4,6-trinitrophenyl)pyridin-2-amine?
The canonical SMILES for N-(2,4,6-trinitrophenyl)pyridin-2-amine is O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccccn2)c([N+](=O)[O-])c1.
What is the InChIKey of N-(2,4,6-trinitrophenyl)pyridin-2-amine?
The InChIKey is DIPBIKKKLNWSEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N5O6/c17-14(18)7-5-8(15(19)20)11(9(6-7)16(21)22)13-10-3-1-2-4-12-10/h1-6H,(H,12,13).
What are the key properties of N-(2,4,6-trinitrophenyl)pyridin-2-amine?
N-(2,4,6-trinitrophenyl)pyridin-2-amine has a molecular weight of 305.21 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4,6-trinitrophenyl)pyridin-2-amine is sourced from PubChem (CID 3089122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).