C16H19N3O3S — CID 3089332
4-[(4-butoxyphenyl)diazenyl]benzenesulfonamide (PubChem CID 3089332) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-[(4-butoxyphenyl)diazenyl]benzenesulfonamide.
| Compound Name | 4-[(4-butoxyphenyl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3089332 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4-[(4-butoxyphenyl)diazenyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(/N=N/c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H19N3O3S/c1-2-3-12-22-15-8-4-13(5-9-15)18-19-14-6-10-16(11-7-14)23(17,20)21/h4-11H,2-3,12H2,1H3,(H2,17,20,21)/b19-18+ |
| InChIKey | OAZYFGIRMOCOHZ-VHEBQXMUSA-N |
| XLogP | 3.93 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|