C8H4F13NO — CID 3089658
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-methylheptanamide (PubChem CID 3089658) has the molecular formula C8H4F13NO and a molecular weight of 377.10 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-methylheptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-methylheptanamide |
|---|---|
| PubChem CID | 3089658 |
| Molecular Formula | C8H4F13NO |
| Molecular Weight | 377.10 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-methylheptanamide |
| SMILES | CNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F13NO/c1-22-2(23)3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1H3,(H,22,23) |
| InChIKey | GMDGDPMNUQLIPP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.10 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|