C12H15F9N2O — CID 3089727
N-(1-ethylpiperidin-3-yl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide (PubChem CID 3089727) has the molecular formula C12H15F9N2O and a molecular weight of 374.25 g/mol. Its IUPAC name is N-(1-ethylpiperidin-3-yl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide.
| Compound Name | N-(1-ethylpiperidin-3-yl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
|---|---|
| PubChem CID | 3089727 |
| Molecular Formula | C12H15F9N2O |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-(1-ethylpiperidin-3-yl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
| SMILES | CCN1CCCC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H15F9N2O/c1-2-23-5-3-4-7(6-23)22-8(24)9(13,14)10(15,16)11(17,18)12(19,20)21/h7H,2-6H2,1H3,(H,22,24) |
| InChIKey | ANNSWZNBLLZOMW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|