C16H24N8 — CID 30897343
2-[4-[4-(piperazin-1-ylmethyl)triazol-1-yl]piperidin-1-yl]pyrimidine (PubChem CID 30897343) has the molecular formula C16H24N8 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-[4-[4-(piperazin-1-ylmethyl)triazol-1-yl]piperidin-1-yl]pyrimidine.
| Compound Name | 2-[4-[4-(piperazin-1-ylmethyl)triazol-1-yl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 30897343 |
| Molecular Formula | C16H24N8 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 2-[4-[4-(piperazin-1-ylmethyl)triazol-1-yl]piperidin-1-yl]pyrimidine |
| SMILES | c1cnc(N2CCC(n3cc(CN4CCNCC4)nn3)CC2)nc1 |
| InChI | InChI=1S/C16H24N8/c1-4-18-16(19-5-1)23-8-2-15(3-9-23)24-13-14(20-21-24)12-22-10-6-17-7-11-22/h1,4-5,13,15,17H,2-3,6-12H2 |
| InChIKey | PSGDGMIFRZHJQI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |