C9H11F8NO3 — CID 3089775
N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,2,3,3,4,4,5,5-octafluoropentanamide (PubChem CID 3089775) has the molecular formula C9H11F8NO3 and a molecular weight of 333.18 g/mol. Its IUPAC name is N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,2,3,3,4,4,5,5-octafluoropentanamide.
| Compound Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,2,3,3,4,4,5,5-octafluoropentanamide |
|---|---|
| PubChem CID | 3089775 |
| Molecular Formula | C9H11F8NO3 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,2,3,3,4,4,5,5-octafluoropentanamide |
| SMILES | CC(CO)(CO)NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H11F8NO3/c1-6(2-19,3-20)18-5(21)8(14,15)9(16,17)7(12,13)4(10)11/h4,19-20H,2-3H2,1H3,(H,18,21) |
| InChIKey | LBOAGDAUXZMRFI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|