C7H11F4NO3 — CID 3089776
N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 3089776) has the molecular formula C7H11F4NO3 and a molecular weight of 233.16 g/mol. Its IUPAC name is N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 3089776 |
| Molecular Formula | C7H11F4NO3 |
| Molecular Weight | 233.16 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CC(CO)(CO)NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H11F4NO3/c1-6(2-13,3-14)12-5(15)7(10,11)4(8)9/h4,13-14H,2-3H2,1H3,(H,12,15) |
| InChIKey | WYARUXWFXYUXLE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|