C13H19NO5 — CID 3089815
N-(3,4-dimethylphenyl)-2,3,4,5-tetrahydroxypentanamide (PubChem CID 3089815) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2,3,4,5-tetrahydroxypentanamide.
| Compound Name | N-(3,4-dimethylphenyl)-2,3,4,5-tetrahydroxypentanamide |
|---|---|
| PubChem CID | 3089815 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2,3,4,5-tetrahydroxypentanamide |
| SMILES | Cc1ccc(NC(=O)C(O)C(O)C(O)CO)cc1C |
| InChI | InChI=1S/C13H19NO5/c1-7-3-4-9(5-8(7)2)14-13(19)12(18)11(17)10(16)6-15/h3-5,10-12,15-18H,6H2,1-2H3,(H,14,19) |
| InChIKey | QNRFMBRRBOYLJH-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |