C19H23N5O — CID 30898812
N-[4-(diethylamino)phenyl]-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxamide (PubChem CID 30898812) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 30898812 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cnc3c(c2)c(C)nn3C)cc1 |
| InChI | InChI=1S/C19H23N5O/c1-5-24(6-2)16-9-7-15(8-10-16)21-19(25)14-11-17-13(3)22-23(4)18(17)20-12-14/h7-12H,5-6H2,1-4H3,(H,21,25) |
| InChIKey | DUAHGJOXBUXJGL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|