C13H10Cl2N4O2 — CID 3089882
N-[(2,6-dichlorophenyl)diazenyl]-2-methyl-4-nitroaniline (PubChem CID 3089882) has the molecular formula C13H10Cl2N4O2 and a molecular weight of 325.16 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)diazenyl]-2-methyl-4-nitroaniline.
| Compound Name | N-[(2,6-dichlorophenyl)diazenyl]-2-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 3089882 |
| Molecular Formula | C13H10Cl2N4O2 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-[(2,6-dichlorophenyl)diazenyl]-2-methyl-4-nitroaniline |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N/N=N/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H10Cl2N4O2/c1-8-7-9(19(20)21)5-6-12(8)16-18-17-13-10(14)3-2-4-11(13)15/h2-7H,1H3,(H,16,17) |
| InChIKey | FRSXLCZYHLTGCY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|