About 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide
2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide (PubChem CID 3089939) has the molecular formula C17H17ClN2O2
and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide |
| PubChem CID | 3089939 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(NC=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H17ClN2O2/c1-11-6-5-7-12(2)15(11)20-17(22)16(19-10-21)13-8-3-4-9-14(13)18/h3-10,16H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | ATRHFXRGWPUVPR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide?
The IUPAC name of 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide (CID 3089939) is 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide.
What is the SMILES notation for 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide?
The canonical SMILES for 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide is Cc1cccc(C)c1NC(=O)C(NC=O)c1ccccc1Cl.
What is the InChIKey of 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide?
The InChIKey is ATRHFXRGWPUVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN2O2/c1-11-6-5-7-12(2)15(11)20-17(22)16(19-10-21)13-8-3-4-9-14(13)18/h3-10,16H,1-2H3,(H,19,21)(H,20,22).
What are the key properties of 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide?
2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide has a molecular weight of 316.79 g/mol, XLogP of 3.38, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)-2-formamidoacetamide is sourced from PubChem (CID 3089939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).