C32H24N2O4 — CID 3090014
1-N,3-N-bis(4-phenoxyphenyl)benzene-1,3-dicarboxamide (PubChem CID 3090014) has the molecular formula C32H24N2O4 and a molecular weight of 500.55 g/mol. Its IUPAC name is 1-N,3-N-bis(4-phenoxyphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(4-phenoxyphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3090014 |
| Molecular Formula | C32H24N2O4 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 1-N,3-N-bis(4-phenoxyphenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1cccc(C(=O)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C32H24N2O4/c35-31(33-25-14-18-29(19-15-25)37-27-10-3-1-4-11-27)23-8-7-9-24(22-23)32(36)34-26-16-20-30(21-17-26)38-28-12-5-2-6-13-28/h1-22H,(H,33,35)(H,34,36) |
| InChIKey | MDLDFYRFWPNAPA-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |