About 1-adamantylmethyl benzoate
1-adamantylmethyl benzoate (PubChem CID 3090072) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-adamantylmethyl benzoate.
Molecular Properties
| Compound Name | 1-adamantylmethyl benzoate |
| PubChem CID | 3090072 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-adamantylmethyl benzoate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C18H22O2/c19-17(16-4-2-1-3-5-16)20-12-18-9-13-6-14(10-18)8-15(7-13)11-18/h1-5,13-15H,6-12H2 |
| InChIKey | NBYUHRBKFIGMSD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantylmethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl benzoate?
The IUPAC name of 1-adamantylmethyl benzoate (CID 3090072) is 1-adamantylmethyl benzoate.
What is the SMILES notation for 1-adamantylmethyl benzoate?
The canonical SMILES for 1-adamantylmethyl benzoate is O=C(OCC12CC3CC(CC(C3)C1)C2)c1ccccc1.
What is the InChIKey of 1-adamantylmethyl benzoate?
The InChIKey is NBYUHRBKFIGMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2/c19-17(16-4-2-1-3-5-16)20-12-18-9-13-6-14(10-18)8-15(7-13)11-18/h1-5,13-15H,6-12H2.
What are the key properties of 1-adamantylmethyl benzoate?
1-adamantylmethyl benzoate has a molecular weight of 270.37 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl benzoate is sourced from PubChem (CID 3090072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).