C18H23Cl5N4O3S — CID 3090183
2,2-dimethyl-N-[2,2,2-trichloro-1-[2-[2,2-dichloro-1-(2,2-dimethylpropanoylamino)ethenyl]sulfanylpyrimidin-4-yl]oxyethyl]propanamide (PubChem CID 3090183) has the molecular formula C18H23Cl5N4O3S and a molecular weight of 552.74 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2,2,2-trichloro-1-[2-[2,2-dichloro-1-(2,2-dimethylpropanoylamino)ethenyl]sulfanylpyrimidin-4-yl]oxyethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-[2-[2,2-dichloro-1-(2,2-dimethylpropanoylamino)ethenyl]sulfanylpyrimidin-4-yl]oxyethyl]propanamide |
|---|---|
| PubChem CID | 3090183 |
| Molecular Formula | C18H23Cl5N4O3S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-[2-[2,2-dichloro-1-(2,2-dimethylpropanoylamino)ethenyl]sulfanylpyrimidin-4-yl]oxyethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NC(Sc1nccc(OC(NC(=O)C(C)(C)C)C(Cl)(Cl)Cl)n1)=C(Cl)Cl |
| InChI | InChI=1S/C18H23Cl5N4O3S/c1-16(2,3)12(28)26-11(10(19)20)31-15-24-8-7-9(25-15)30-14(18(21,22)23)27-13(29)17(4,5)6/h7-8,14H,1-6H3,(H,26,28)(H,27,29) |
| InChIKey | ZLRKJOYKKJKVHK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|