C11H18ClF6N2O2+ — CID 3090435
3-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]propyl-(2-hydroxyethyl)-dimethylazanium (PubChem CID 3090435) has the molecular formula C11H18ClF6N2O2+ and a molecular weight of 359.72 g/mol. Its IUPAC name is 3-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]propyl-(2-hydroxyethyl)-dimethylazanium.
| Compound Name | 3-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]propyl-(2-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 3090435 |
| Molecular Formula | C11H18ClF6N2O2+ |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 3-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]propyl-(2-hydroxyethyl)-dimethylazanium |
| SMILES | C[N+](C)(CCO)CCCNC(=O)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C11H17ClF6N2O2/c1-20(2,6-7-21)5-3-4-19-8(22)9(13,14)10(15,16)11(12,17)18/h21H,3-7H2,1-2H3/p+1 |
| InChIKey | QQDJAWOKHSYZAP-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|