C22H14Br2N2O2 — CID 3090604
2-[2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]-3-phenylquinazolin-4-one (PubChem CID 3090604) has the molecular formula C22H14Br2N2O2 and a molecular weight of 498.17 g/mol. Its IUPAC name is 2-[2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]-3-phenylquinazolin-4-one.
| Compound Name | 2-[2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 3090604 |
| Molecular Formula | C22H14Br2N2O2 |
| Molecular Weight | 498.17 g/mol |
| Exact Mass | 495.94 |
| IUPAC Name | 2-[2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]-3-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C=Cc2cc(Br)cc(Br)c2O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H14Br2N2O2/c23-15-12-14(21(27)18(24)13-15)10-11-20-25-19-9-5-4-8-17(19)22(28)26(20)16-6-2-1-3-7-16/h1-13,27H |
| InChIKey | VGKTTZTZTGGTTP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.17 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |