About 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione
1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione (PubChem CID 3090916) has the molecular formula C14H6N2O8
and a molecular weight of 330.21 g/mol. Its IUPAC name is 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione.
Molecular Properties
| Compound Name | 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione |
| PubChem CID | 3090916 |
| Molecular Formula | C14H6N2O8 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc([N+](=O)[O-])c2C(=O)c2c(O)ccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C14H6N2O8/c17-7-3-1-5(15(21)22)9-11(7)14(20)10-6(16(23)24)2-4-8(18)12(10)13(9)19/h1-4,17-18H |
| InChIKey | CUIHODIOWPLCMG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione?
The IUPAC name of 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione (CID 3090916) is 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione.
What is the SMILES notation for 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione?
The canonical SMILES for 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione is O=C1c2c(O)ccc([N+](=O)[O-])c2C(=O)c2c(O)ccc([N+](=O)[O-])c21.
What is the InChIKey of 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione?
The InChIKey is CUIHODIOWPLCMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6N2O8/c17-7-3-1-5(15(21)22)9-11(7)14(20)10-6(16(23)24)2-4-8(18)12(10)13(9)19/h1-4,17-18H.
What are the key properties of 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione?
1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione has a molecular weight of 330.21 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydroxy-4,8-dinitroanthracene-9,10-dione is sourced from PubChem (CID 3090916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).