C9H17Cl3N2O — CID 3091311
2,2-dimethyl-N-[2,2,2-trichloro-1-(dimethylamino)ethyl]propanamide (PubChem CID 3091311) has the molecular formula C9H17Cl3N2O and a molecular weight of 275.61 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2,2,2-trichloro-1-(dimethylamino)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-(dimethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 3091311 |
| Molecular Formula | C9H17Cl3N2O |
| Molecular Weight | 275.61 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-(dimethylamino)ethyl]propanamide |
| SMILES | CN(C)C(NC(=O)C(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H17Cl3N2O/c1-8(2,3)7(15)13-6(14(4)5)9(10,11)12/h6H,1-5H3,(H,13,15) |
| InChIKey | AQZJEDSVTATRKR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|