C15H17FeNO — CID 3091760
cyclopenta-1,3-diene;5-cyclopenta-1,3-dien-1-yl-3-ethyl-4,5-dihydro-1,2-oxazole;iron(2+) (PubChem CID 3091760) has the molecular formula C15H17FeNO and a molecular weight of 283.15 g/mol. Its IUPAC name is cyclopenta-1,3-diene;5-cyclopenta-1,3-dien-1-yl-3-ethyl-4,5-dihydro-1,2-oxazole;iron(2+).
| Compound Name | cyclopenta-1,3-diene;5-cyclopenta-1,3-dien-1-yl-3-ethyl-4,5-dihydro-1,2-oxazole;iron(2+) |
|---|---|
| PubChem CID | 3091760 |
| Molecular Formula | C15H17FeNO |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | cyclopenta-1,3-diene;5-cyclopenta-1,3-dien-1-yl-3-ethyl-4,5-dihydro-1,2-oxazole;iron(2+) |
| SMILES | CCC1=NOC(c2ccc[cH-]2)C1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C10H12NO.C5H5.Fe/c1-2-9-7-10(12-11-9)8-5-3-4-6-8;1-2-4-5-3-1;/h3-6,10H,2,7H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | XCNLOGZRKMBJLB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|