C26H20N4 — CID 3091806
1,3,4,6-tetraphenyl-1,2,4,5-tetrazine (PubChem CID 3091806) has the molecular formula C26H20N4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1,3,4,6-tetraphenyl-1,2,4,5-tetrazine.
| Compound Name | 1,3,4,6-tetraphenyl-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 3091806 |
| Molecular Formula | C26H20N4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1,3,4,6-tetraphenyl-1,2,4,5-tetrazine |
| SMILES | c1ccc(C2=NN(c3ccccc3)C(c3ccccc3)=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20N4/c1-5-13-21(14-6-1)25-27-30(24-19-11-4-12-20-24)26(22-15-7-2-8-16-22)28-29(25)23-17-9-3-10-18-23/h1-20H |
| InChIKey | UGHPWAQUZDYJGP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |