C15H16N6 — CID 3091883
1-[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]-2-phenylhydrazine (PubChem CID 3091883) has the molecular formula C15H16N6 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]-2-phenylhydrazine.
| Compound Name | 1-[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 3091883 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]-2-phenylhydrazine |
| SMILES | Cc1cc(C)n(-c2cc(NNc3ccccc3)ncn2)n1 |
| InChI | InChI=1S/C15H16N6/c1-11-8-12(2)21(20-11)15-9-14(16-10-17-15)19-18-13-6-4-3-5-7-13/h3-10,18H,1-2H3,(H,16,17,19) |
| InChIKey | MMBABSKGKLAZFC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|