About 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium
2-methyl-4,6-bis(4-propoxyphenyl)pyrylium (PubChem CID 3092041) has the molecular formula C24H27O3+
and a molecular weight of 363.48 g/mol. Its IUPAC name is 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium.
Molecular Properties
| Compound Name | 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium |
| PubChem CID | 3092041 |
| Molecular Formula | C24H27O3+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium |
| SMILES | CCCOc1ccc(-c2cc(C)[o+]c(-c3ccc(OCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H27O3/c1-4-14-25-22-10-6-19(7-11-22)21-16-18(3)27-24(17-21)20-8-12-23(13-9-20)26-15-5-2/h6-13,16-17H,4-5,14-15H2,1-3H3/q+1 |
| InChIKey | ACVODYJYDSMSPC-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium?
The IUPAC name of 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium (CID 3092041) is 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium.
What is the SMILES notation for 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium?
The canonical SMILES for 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium is CCCOc1ccc(-c2cc(C)[o+]c(-c3ccc(OCCC)cc3)c2)cc1.
What is the InChIKey of 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium?
The InChIKey is ACVODYJYDSMSPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27O3/c1-4-14-25-22-10-6-19(7-11-22)21-16-18(3)27-24(17-21)20-8-12-23(13-9-20)26-15-5-2/h6-13,16-17H,4-5,14-15H2,1-3H3/q+1.
What are the key properties of 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium?
2-methyl-4,6-bis(4-propoxyphenyl)pyrylium has a molecular weight of 363.48 g/mol, XLogP of 6.78, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,6-bis(4-propoxyphenyl)pyrylium is sourced from PubChem (CID 3092041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).