About (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone
(5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone (PubChem CID 3092071) has the molecular formula C31H21NO2
and a molecular weight of 439.51 g/mol. Its IUPAC name is (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone.
Molecular Properties
| Compound Name | (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone |
| PubChem CID | 3092071 |
| Molecular Formula | C31H21NO2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(C(=O)c2ccccc2)c(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C31H21NO2/c33-30(24-17-9-3-10-18-24)26-21-27(31(34)25-19-11-4-12-20-25)29(23-15-7-2-8-16-23)32-28(26)22-13-5-1-6-14-22/h1-21H |
| InChIKey | LEVXACYCGIKDER-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone?
The IUPAC name of (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone (CID 3092071) is (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone.
What is the SMILES notation for (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone?
The canonical SMILES for (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone is O=C(c1ccccc1)c1cc(C(=O)c2ccccc2)c(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone?
The InChIKey is LEVXACYCGIKDER-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H21NO2/c33-30(24-17-9-3-10-18-24)26-21-27(31(34)25-19-11-4-12-20-25)29(23-15-7-2-8-16-23)32-28(26)22-13-5-1-6-14-22/h1-21H.
What are the key properties of (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone?
(5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone has a molecular weight of 439.51 g/mol, XLogP of 6.88, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzoyl-2,6-diphenyl-3-pyridinyl)-phenylmethanone is sourced from PubChem (CID 3092071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).