C26H44N2O2 — CID 3092151
N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-N'-(2,7,7-trimethyl-1-bicyclo[2.2.1]heptanyl)hexanediamide (PubChem CID 3092151) has the molecular formula C26H44N2O2 and a molecular weight of 416.65 g/mol. Its IUPAC name is N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-N'-(2,7,7-trimethyl-1-bicyclo[2.2.1]heptanyl)hexanediamide.
| Compound Name | N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-N'-(2,7,7-trimethyl-1-bicyclo[2.2.1]heptanyl)hexanediamide |
|---|---|
| PubChem CID | 3092151 |
| Molecular Formula | C26H44N2O2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-N'-(2,7,7-trimethyl-1-bicyclo[2.2.1]heptanyl)hexanediamide |
| SMILES | CC1CC2CCC1(NC(=O)CCCCC(=O)NC1CC3CCC1(C)C3(C)C)C2(C)C |
| InChI | InChI=1S/C26H44N2O2/c1-17-15-18-12-14-26(17,24(18,4)5)28-22(30)10-8-7-9-21(29)27-20-16-19-11-13-25(20,6)23(19,2)3/h17-20H,7-16H2,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | ISINGHVAECMBPX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|