About 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide
3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide (PubChem CID 3092661) has the molecular formula C15H11Cl4N3O3
and a molecular weight of 423.08 g/mol. Its IUPAC name is 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide.
Molecular Properties
| Compound Name | 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide |
| PubChem CID | 3092661 |
| Molecular Formula | C15H11Cl4N3O3 |
| Molecular Weight | 423.08 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide |
| SMILES | O=C(NC(Nc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl4N3O3/c16-10-3-1-2-9(8-10)13(23)21-14(15(17,18)19)20-11-4-6-12(7-5-11)22(24)25/h1-8,14,20H,(H,21,23) |
| InChIKey | DVCJERCOQMMOQB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.08 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide?
The IUPAC name of 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide (CID 3092661) is 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide.
What is the SMILES notation for 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide?
The canonical SMILES for 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide is O=C(NC(Nc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl)c1cccc(Cl)c1.
What is the InChIKey of 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide?
The InChIKey is DVCJERCOQMMOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl4N3O3/c16-10-3-1-2-9(8-10)13(23)21-14(15(17,18)19)20-11-4-6-12(7-5-11)22(24)25/h1-8,14,20H,(H,21,23).
What are the key properties of 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide?
3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide has a molecular weight of 423.08 g/mol, XLogP of 4.79, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]benzamide is sourced from PubChem (CID 3092661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).