C19H23NO4 — CID 30927259
[2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 30927259) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 30927259 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)c1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-5-6-7-8-17(22)24-13-16(21)14-9-11-15(12-10-14)20-18(23)19(2,3)4/h5-12H,13H2,1-4H3,(H,20,23)/b6-5+,8-7+ |
| InChIKey | VYFZUOCXSLLIKJ-BSWSSELBSA-N |
| XLogP | 3.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|