C26H21N7O — CID 3092798
1-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]naphthalen-2-ol (PubChem CID 3092798) has the molecular formula C26H21N7O and a molecular weight of 447.50 g/mol. Its IUPAC name is 1-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]naphthalen-2-ol.
| Compound Name | 1-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 3092798 |
| Molecular Formula | C26H21N7O |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1C=NNc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C26H21N7O/c34-23-16-15-18-9-7-8-14-21(18)22(23)17-27-33-26-31-24(28-19-10-3-1-4-11-19)30-25(32-26)29-20-12-5-2-6-13-20/h1-17,34H,(H3,28,29,30,31,32,33) |
| InChIKey | JFIAYZDAWAEUOS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|