C12H5F5N2 — CID 3092877
(2,3,4,5,6-pentafluorophenyl)-phenyldiazene (PubChem CID 3092877) has the molecular formula C12H5F5N2 and a molecular weight of 272.18 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-phenyldiazene.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-phenyldiazene |
|---|---|
| PubChem CID | 3092877 |
| Molecular Formula | C12H5F5N2 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-phenyldiazene |
| SMILES | Fc1c(F)c(F)c(/N=N/c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C12H5F5N2/c13-7-8(14)10(16)12(11(17)9(7)15)19-18-6-4-2-1-3-5-6/h1-5H/b19-18+ |
| InChIKey | BMCAYVUKZRCOSD-VHEBQXMUSA-N |
| XLogP | 4.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|