C20H19N2S+ — CID 3093347
2-[(1,4-dimethylquinolin-1-ium-2-yl)methylidene]-3-methyl-1,3-benzothiazole (PubChem CID 3093347) has the molecular formula C20H19N2S+ and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[(1,4-dimethylquinolin-1-ium-2-yl)methylidene]-3-methyl-1,3-benzothiazole.
| Compound Name | 2-[(1,4-dimethylquinolin-1-ium-2-yl)methylidene]-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 3093347 |
| Molecular Formula | C20H19N2S+ |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[(1,4-dimethylquinolin-1-ium-2-yl)methylidene]-3-methyl-1,3-benzothiazole |
| SMILES | Cc1cc(C=C2Sc3ccccc3N2C)[n+](C)c2ccccc12 |
| InChI | InChI=1S/C20H19N2S/c1-14-12-15(21(2)17-9-5-4-8-16(14)17)13-20-22(3)18-10-6-7-11-19(18)23-20/h4-13H,1-3H3/q+1 |
| InChIKey | RPTMJVXFFUTCFQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|