C22H16F3N3OS — CID 3093509
2,5-diphenyl-6-phenylimino-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one (PubChem CID 3093509) has the molecular formula C22H16F3N3OS and a molecular weight of 427.45 g/mol. Its IUPAC name is 2,5-diphenyl-6-phenylimino-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one.
| Compound Name | 2,5-diphenyl-6-phenylimino-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 3093509 |
| Molecular Formula | C22H16F3N3OS |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2,5-diphenyl-6-phenylimino-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
| SMILES | O=C1NC(c2ccccc2)(C(F)(F)F)S/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H16F3N3OS/c23-22(24,25)21(16-10-4-1-5-11-16)27-19(29)28(18-14-8-3-9-15-18)20(30-21)26-17-12-6-2-7-13-17/h1-15H,(H,27,29)/b26-20- |
| InChIKey | BKVSGKFSOGKEMG-QOMWVZHYSA-N |
| XLogP | 6.05 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|