About [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate
[4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate (PubChem CID 3093517) has the molecular formula C16H16O8S3
and a molecular weight of 432.50 g/mol. Its IUPAC name is [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate.
Molecular Properties
| Compound Name | [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate |
| PubChem CID | 3093517 |
| Molecular Formula | C16H16O8S3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate |
| SMILES | O=S1(=O)CC(OS(=O)(=O)c2ccccc2)C(OS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H16O8S3/c17-25(18)11-15(23-26(19,20)13-7-3-1-4-8-13)16(12-25)24-27(21,22)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | CXJFKXKGNJXNJE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate?
The IUPAC name of [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate (CID 3093517) is [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate.
What is the SMILES notation for [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate?
The canonical SMILES for [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate is O=S1(=O)CC(OS(=O)(=O)c2ccccc2)C(OS(=O)(=O)c2ccccc2)C1.
What is the InChIKey of [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate?
The InChIKey is CXJFKXKGNJXNJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O8S3/c17-25(18)11-15(23-26(19,20)13-7-3-1-4-8-13)16(12-25)24-27(21,22)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2.
What are the key properties of [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate?
[4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate has a molecular weight of 432.50 g/mol, XLogP of 0.96, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzenesulfonyloxy)-1,1-dioxothiolan-3-yl] benzenesulfonate is sourced from PubChem (CID 3093517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).