About ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate
ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate (PubChem CID 3093519) has the molecular formula C7H13NO2S3
and a molecular weight of 239.39 g/mol. Its IUPAC name is ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate.
Molecular Properties
| Compound Name | ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
| PubChem CID | 3093519 |
| Molecular Formula | C7H13NO2S3 |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
| SMILES | CCSC(=S)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13NO2S3/c1-2-12-7(11)8-6-3-4-13(9,10)5-6/h6H,2-5H2,1H3,(H,8,11) |
| InChIKey | LJAXSYJYCQOYLP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
The IUPAC name of ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate (CID 3093519) is ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate.
What is the SMILES notation for ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
The canonical SMILES for ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate is CCSC(=S)NC1CCS(=O)(=O)C1.
What is the InChIKey of ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
The InChIKey is LJAXSYJYCQOYLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S3/c1-2-12-7(11)8-6-3-4-13(9,10)5-6/h6H,2-5H2,1H3,(H,8,11).
What are the key properties of ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate has a molecular weight of 239.39 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(1,1-dioxothiolan-3-yl)carbamodithioate is sourced from PubChem (CID 3093519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).