C21H18ClN3O4 — CID 30935895
ethyl 2-[[2-[4-(4-chlorophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]benzoate (PubChem CID 30935895) has the molecular formula C21H18ClN3O4 and a molecular weight of 411.85 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(4-chlorophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[4-(4-chlorophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30935895 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | ethyl 2-[[2-[4-(4-chlorophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Cn1cnc(-c2ccc(Cl)cc2)cc1=O |
| InChI | InChI=1S/C21H18ClN3O4/c1-2-29-21(28)16-5-3-4-6-17(16)24-19(26)12-25-13-23-18(11-20(25)27)14-7-9-15(22)10-8-14/h3-11,13H,2,12H2,1H3,(H,24,26) |
| InChIKey | LYUFOEUCMWSAON-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |