About diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate
diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 3093646) has the molecular formula C27H31BrN2O4
and a molecular weight of 527.46 g/mol. Its IUPAC name is diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
| PubChem CID | 3093646 |
| Molecular Formula | C27H31BrN2O4 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(N(C)C)cc2)C(C)=C(C(=O)OCC)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H31BrN2O4/c1-7-33-26(31)23-17(3)30(22-15-13-21(14-16-22)29(5)6)18(4)24(27(32)34-8-2)25(23)19-9-11-20(28)12-10-19/h9-16,25H,7-8H2,1-6H3 |
| InChIKey | AIXUYMZTCIRTLM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate (CID 3093646) is diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate is CCOC(=O)C1=C(C)N(c2ccc(N(C)C)cc2)C(C)=C(C(=O)OCC)C1c1ccc(Br)cc1.
What is the InChIKey of diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate?
The InChIKey is AIXUYMZTCIRTLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31BrN2O4/c1-7-33-26(31)23-17(3)30(22-15-13-21(14-16-22)29(5)6)18(4)24(27(32)34-8-2)25(23)19-9-11-20(28)12-10-19/h9-16,25H,7-8H2,1-6H3.
What are the key properties of diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate?
diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate has a molecular weight of 527.46 g/mol, XLogP of 5.79, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-(4-bromophenyl)-1-[4-(dimethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 3093646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).