C8H4N8O6 — CID 3093656
4-(4,6-dinitro-1-oxidobenzotriazol-1-ium-2-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 3093656) has the molecular formula C8H4N8O6 and a molecular weight of 308.17 g/mol. Its IUPAC name is 4-(4,6-dinitro-1-oxidobenzotriazol-1-ium-2-yl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(4,6-dinitro-1-oxidobenzotriazol-1-ium-2-yl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 3093656 |
| Molecular Formula | C8H4N8O6 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 4-(4,6-dinitro-1-oxidobenzotriazol-1-ium-2-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-n1nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[n+]1[O-] |
| InChI | InChI=1S/C8H4N8O6/c9-7-8(12-22-11-7)13-10-6-4(14(13)17)1-3(15(18)19)2-5(6)16(20)21/h1-2H,(H2,9,11) |
| InChIKey | AKWZYGZZNLGUBZ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|