C9H10Cl3N3O4 — CID 3093674
ethyl N-[2,2,2-trichloro-1-(2,4-dioxopyrimidin-1-yl)ethyl]carbamate (PubChem CID 3093674) has the molecular formula C9H10Cl3N3O4 and a molecular weight of 330.56 g/mol. Its IUPAC name is ethyl N-[2,2,2-trichloro-1-(2,4-dioxopyrimidin-1-yl)ethyl]carbamate.
| Compound Name | ethyl N-[2,2,2-trichloro-1-(2,4-dioxopyrimidin-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 3093674 |
| Molecular Formula | C9H10Cl3N3O4 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | ethyl N-[2,2,2-trichloro-1-(2,4-dioxopyrimidin-1-yl)ethyl]carbamate |
| SMILES | CCOC(=O)NC(n1ccc(=O)[nH]c1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H10Cl3N3O4/c1-2-19-8(18)14-6(9(10,11)12)15-4-3-5(16)13-7(15)17/h3-4,6H,2H2,1H3,(H,14,18)(H,13,16,17) |
| InChIKey | CAXFSUTVBDAIGX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|