C19H27N5O2 — CID 30936775
[4-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]piperidin-1-yl]-[4-(propylamino)phenyl]methanone (PubChem CID 30936775) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is [4-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]piperidin-1-yl]-[4-(propylamino)phenyl]methanone.
| Compound Name | [4-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]piperidin-1-yl]-[4-(propylamino)phenyl]methanone |
|---|---|
| PubChem CID | 30936775 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | [4-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]piperidin-1-yl]-[4-(propylamino)phenyl]methanone |
| SMILES | CCCNc1ccc(C(=O)N2CCC(n3cc([C@@H](C)O)nn3)CC2)cc1 |
| InChI | InChI=1S/C19H27N5O2/c1-3-10-20-16-6-4-15(5-7-16)19(26)23-11-8-17(9-12-23)24-13-18(14(2)25)21-22-24/h4-7,13-14,17,20,25H,3,8-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | AAYKJSNAWIYTSK-CQSZACIVSA-N |
| XLogP | 2.63 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |