C23H36N2O3 — CID 3093891
4-butoxy-N'-(4-pentylcyclohexanecarbonyl)benzohydrazide (PubChem CID 3093891) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is 4-butoxy-N'-(4-pentylcyclohexanecarbonyl)benzohydrazide.
| Compound Name | 4-butoxy-N'-(4-pentylcyclohexanecarbonyl)benzohydrazide |
|---|---|
| PubChem CID | 3093891 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | 4-butoxy-N'-(4-pentylcyclohexanecarbonyl)benzohydrazide |
| SMILES | CCCCCC1CCC(C(=O)NNC(=O)c2ccc(OCCCC)cc2)CC1 |
| InChI | InChI=1S/C23H36N2O3/c1-3-5-7-8-18-9-11-19(12-10-18)22(26)24-25-23(27)20-13-15-21(16-14-20)28-17-6-4-2/h13-16,18-19H,3-12,17H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | NXVFYGBALITRQH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|