C24H20N4O5S3 — CID 3093963
3-[(4Z)-3-methyl-4-[(5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-5-oxopyrazol-1-yl]benzenesulfonic acid (PubChem CID 3093963) has the molecular formula C24H20N4O5S3 and a molecular weight of 540.65 g/mol. Its IUPAC name is 3-[(4Z)-3-methyl-4-[(5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-5-oxopyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 3-[(4Z)-3-methyl-4-[(5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-5-oxopyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 3093963 |
| Molecular Formula | C24H20N4O5S3 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 3-[(4Z)-3-methyl-4-[(5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-5-oxopyrazol-1-yl]benzenesulfonic acid |
| SMILES | C=CCn1c(=O)/c(=C2/Sc3ccccc3N2C)s/c1=C1\C(=O)N(c2cccc(S(=O)(=O)O)c2)N=C1C |
| InChI | InChI=1S/C24H20N4O5S3/c1-4-12-27-22(30)20(24-26(3)17-10-5-6-11-18(17)34-24)35-23(27)19-14(2)25-28(21(19)29)15-8-7-9-16(13-15)36(31,32)33/h4-11,13H,1,12H2,2-3H3,(H,31,32,33)/b23-19-,24-20- |
| InChIKey | NIRRZPRFTIEDOV-SRPFLQSCSA-N |
| XLogP | 2.22 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|