C18H20FN3OS — CID 30940095
N-butyl-3-[6-(2-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanamide (PubChem CID 30940095) has the molecular formula C18H20FN3OS and a molecular weight of 345.44 g/mol. Its IUPAC name is N-butyl-3-[6-(2-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanamide.
| Compound Name | N-butyl-3-[6-(2-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanamide |
|---|---|
| PubChem CID | 30940095 |
| Molecular Formula | C18H20FN3OS |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-butyl-3-[6-(2-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanamide |
| SMILES | CCCCNC(=O)CCc1csc2nc(-c3ccccc3F)cn12 |
| InChI | InChI=1S/C18H20FN3OS/c1-2-3-10-20-17(23)9-8-13-12-24-18-21-16(11-22(13)18)14-6-4-5-7-15(14)19/h4-7,11-12H,2-3,8-10H2,1H3,(H,20,23) |
| InChIKey | YUQXNEJHZDUTKK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|