C18H16BrN3OS — CID 30940457
2-(2-anilino-1,3-thiazol-4-yl)-N-(4-bromo-2-methylphenyl)acetamide (PubChem CID 30940457) has the molecular formula C18H16BrN3OS and a molecular weight of 402.32 g/mol. Its IUPAC name is 2-(2-anilino-1,3-thiazol-4-yl)-N-(4-bromo-2-methylphenyl)acetamide.
| Compound Name | 2-(2-anilino-1,3-thiazol-4-yl)-N-(4-bromo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 30940457 |
| Molecular Formula | C18H16BrN3OS |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-(2-anilino-1,3-thiazol-4-yl)-N-(4-bromo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)Cc1csc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H16BrN3OS/c1-12-9-13(19)7-8-16(12)22-17(23)10-15-11-24-18(21-15)20-14-5-3-2-4-6-14/h2-9,11H,10H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | AYVJLQLRIURRGL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |