C18H16ClN3O3S2 — CID 30942363
N-(3-chlorophenyl)-2-[2-(4-methylsulfonylanilino)-1,3-thiazol-4-yl]acetamide (PubChem CID 30942363) has the molecular formula C18H16ClN3O3S2 and a molecular weight of 421.93 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[2-(4-methylsulfonylanilino)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[2-(4-methylsulfonylanilino)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 30942363 |
| Molecular Formula | C18H16ClN3O3S2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | N-(3-chlorophenyl)-2-[2-(4-methylsulfonylanilino)-1,3-thiazol-4-yl]acetamide |
| SMILES | CS(=O)(=O)c1ccc(Nc2nc(CC(=O)Nc3cccc(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C18H16ClN3O3S2/c1-27(24,25)16-7-5-13(6-8-16)21-18-22-15(11-26-18)10-17(23)20-14-4-2-3-12(19)9-14/h2-9,11H,10H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | CJGUQBUXTJTQKN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |