C45H44N2O9 — CID 3094536
heptyl 4-[5-[2-(4-heptoxycarbonylphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 3094536) has the molecular formula C45H44N2O9 and a molecular weight of 756.85 g/mol. Its IUPAC name is heptyl 4-[5-[2-(4-heptoxycarbonylphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | heptyl 4-[5-[2-(4-heptoxycarbonylphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 3094536 |
| Molecular Formula | C45H44N2O9 |
| Molecular Weight | 756.85 g/mol |
| Exact Mass | 756.30 |
| IUPAC Name | heptyl 4-[5-[2-(4-heptoxycarbonylphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | CCCCCCCOC(=O)c1ccc(N2C(=O)c3ccc(C(=O)c4ccc5c(c4)C(=O)N(c4ccc(C(=O)OCCCCCCC)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C45H44N2O9/c1-3-5-7-9-11-25-55-44(53)29-13-19-33(20-14-29)46-40(49)35-23-17-31(27-37(35)42(46)51)39(48)32-18-24-36-38(28-32)43(52)47(41(36)50)34-21-15-30(16-22-34)45(54)56-26-12-10-8-6-4-2/h13-24,27-28H,3-12,25-26H2,1-2H3 |
| InChIKey | CTFVNJCASHPIBE-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 144.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.85 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|