C21H19N3O2S2 — CID 3094696
(5Z)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-phenylimino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 3094696) has the molecular formula C21H19N3O2S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is (5Z)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-phenylimino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-phenylimino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3094696 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (5Z)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-phenylimino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C2/Sc3ccc(OC)cc3N2C)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C21H19N3O2S2/c1-4-12-24-19(25)18(28-21(24)22-14-8-6-5-7-9-14)20-23(2)16-13-15(26-3)10-11-17(16)27-20/h4-11,13H,1,12H2,2-3H3/b20-18-,22-21- |
| InChIKey | RKLPYAUTIVQHDN-QHQVFXOCSA-N |
| XLogP | 4.86 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|