C27H18N6 — CID 3095008
4,9,14-triphenyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene (PubChem CID 3095008) has the molecular formula C27H18N6 and a molecular weight of 426.48 g/mol. Its IUPAC name is 4,9,14-triphenyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene.
| Compound Name | 4,9,14-triphenyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene |
|---|---|
| PubChem CID | 3095008 |
| Molecular Formula | C27H18N6 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4,9,14-triphenyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene |
| SMILES | c1ccc(-c2cc3n(n2)c2cc(-c4ccccc4)nn2c2cc(-c4ccccc4)nn32)cc1 |
| InChI | InChI=1S/C27H18N6/c1-4-10-19(11-5-1)22-16-25-31(28-22)26-17-23(20-12-6-2-7-13-20)30-33(26)27-18-24(29-32(25)27)21-14-8-3-9-15-21/h1-18H |
| InChIKey | XCHPHOSDFRSBBC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 51.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |