About 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide
4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide (PubChem CID 3095243) has the molecular formula C19H30N2O6S
and a molecular weight of 414.52 g/mol. Its IUPAC name is 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide |
| PubChem CID | 3095243 |
| Molecular Formula | C19H30N2O6S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)N1CCOCCOCCOCC1 |
| InChI | InChI=1S/C19H30N2O6S/c1-3-18(20-28(23,24)17-6-4-16(2)5-7-17)19(22)21-8-10-25-12-14-27-15-13-26-11-9-21/h4-7,18,20H,3,8-15H2,1-2H3 |
| InChIKey | WBOPWTUVKVPFNL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide?
The IUPAC name of 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide (CID 3095243) is 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide.
What is the SMILES notation for 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide?
The canonical SMILES for 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide is CCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)N1CCOCCOCCOCC1.
What is the InChIKey of 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide?
The InChIKey is WBOPWTUVKVPFNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O6S/c1-3-18(20-28(23,24)17-6-4-16(2)5-7-17)19(22)21-8-10-25-12-14-27-15-13-26-11-9-21/h4-7,18,20H,3,8-15H2,1-2H3.
What are the key properties of 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide?
4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide has a molecular weight of 414.52 g/mol, XLogP of 0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-2-yl]benzenesulfonamide is sourced from PubChem (CID 3095243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).