C22H32N4O3S — CID 30954449
3-[cyclohexyl(methyl)sulfamoyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]benzamide (PubChem CID 30954449) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 3-[cyclohexyl(methyl)sulfamoyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]benzamide.
| Compound Name | 3-[cyclohexyl(methyl)sulfamoyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 30954449 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-[cyclohexyl(methyl)sulfamoyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]benzamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2cccc(S(=O)(=O)N(C)C3CCCCC3)c2)n1 |
| InChI | InChI=1S/C22H32N4O3S/c1-17-15-18(2)26(24-17)14-8-13-23-22(27)19-9-7-12-21(16-19)30(28,29)25(3)20-10-5-4-6-11-20/h7,9,12,15-16,20H,4-6,8,10-11,13-14H2,1-3H3,(H,23,27) |
| InChIKey | ZIPLXMGAMGPGIH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|