C27H26N4O8 — CID 3095551
[3-[[[2-(4-tert-butyl-2-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate (PubChem CID 3095551) has the molecular formula C27H26N4O8 and a molecular weight of 534.53 g/mol. Its IUPAC name is [3-[[[2-(4-tert-butyl-2-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate.
| Compound Name | [3-[[[2-(4-tert-butyl-2-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 3095551 |
| Molecular Formula | C27H26N4O8 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | [3-[[[2-(4-tert-butyl-2-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate |
| SMILES | Cc1cc(C(C)(C)C)ccc1OCC(=O)NN=Cc1cccc(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C27H26N4O8/c1-17-10-20(27(2,3)4)8-9-24(17)38-16-25(32)29-28-15-18-6-5-7-23(11-18)39-26(33)19-12-21(30(34)35)14-22(13-19)31(36)37/h5-15H,16H2,1-4H3,(H,29,32) |
| InChIKey | GMIFUZUSRNABJY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 163.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|