C18H26N8O — CID 30956850
4-[[1-[[1-(3-methylpyrazin-2-yl)piperidin-4-yl]methyl]triazol-4-yl]methyl]piperazin-2-one (PubChem CID 30956850) has the molecular formula C18H26N8O and a molecular weight of 370.46 g/mol. Its IUPAC name is 4-[[1-[[1-(3-methylpyrazin-2-yl)piperidin-4-yl]methyl]triazol-4-yl]methyl]piperazin-2-one.
| Compound Name | 4-[[1-[[1-(3-methylpyrazin-2-yl)piperidin-4-yl]methyl]triazol-4-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 30956850 |
| Molecular Formula | C18H26N8O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 4-[[1-[[1-(3-methylpyrazin-2-yl)piperidin-4-yl]methyl]triazol-4-yl]methyl]piperazin-2-one |
| SMILES | Cc1nccnc1N1CCC(Cn2cc(CN3CCNC(=O)C3)nn2)CC1 |
| InChI | InChI=1S/C18H26N8O/c1-14-18(21-5-4-19-14)25-7-2-15(3-8-25)10-26-12-16(22-23-26)11-24-9-6-20-17(27)13-24/h4-5,12,15H,2-3,6-11,13H2,1H3,(H,20,27) |
| InChIKey | NGLBZYFOTPXPDJ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |