C14H21NO4 — CID 3095722
2-(3,4-dimethylanilino)-6-methyloxane-3,4,5-triol (PubChem CID 3095722) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-6-methyloxane-3,4,5-triol.
| Compound Name | 2-(3,4-dimethylanilino)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 3095722 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-(3,4-dimethylanilino)-6-methyloxane-3,4,5-triol |
| SMILES | Cc1ccc(NC2OC(C)C(O)C(O)C2O)cc1C |
| InChI | InChI=1S/C14H21NO4/c1-7-4-5-10(6-8(7)2)15-14-13(18)12(17)11(16)9(3)19-14/h4-6,9,11-18H,1-3H3 |
| InChIKey | JWZXDMQOJGLNJM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |